About N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide
N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide (PubChem CID 167482147) has the molecular formula C11H17N3O2
and a molecular weight of 223.28 g/mol. Its IUPAC name is N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide |
| PubChem CID | 167482147 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NC(C#N)CC1CC(C)(C)NC1=O |
| InChI | InChI=1S/C11H17N3O2/c1-7(15)13-9(6-12)4-8-5-11(2,3)14-10(8)16/h8-9H,4-5H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | VAVLNNYEYJGPCX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide?
The IUPAC name of N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide (CID 167482147) is N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide?
The canonical SMILES for N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide is CC(=O)NC(C#N)CC1CC(C)(C)NC1=O.
What is the InChIKey of N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide?
The InChIKey is VAVLNNYEYJGPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-7(15)13-9(6-12)4-8-5-11(2,3)14-10(8)16/h8-9H,4-5H2,1-3H3,(H,13,15)(H,14,16).
What are the key properties of N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide?
N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide has a molecular weight of 223.28 g/mol, XLogP of 0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-cyano-2-(5,5-dimethyl-2-oxopyrrolidin-3-yl)ethyl]acetamide is sourced from PubChem (CID 167482147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).