C15H27F3N2O — CID 167482173
1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone;2-methylpropane (PubChem CID 167482173) has the molecular formula C15H27F3N2O and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone;2-methylpropane.
| Compound Name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone;2-methylpropane |
|---|---|
| PubChem CID | 167482173 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,2,2-trifluoroethylamino)ethanone;2-methylpropane |
| SMILES | CC(C)C.O=C(CNCC(F)(F)F)N1CC2CCCC2C1 |
| InChI | InChI=1S/C11H17F3N2O.C4H10/c12-11(13,14)7-15-4-10(17)16-5-8-2-1-3-9(8)6-16;1-4(2)3/h8-9,15H,1-7H2;4H,1-3H3 |
| InChIKey | DAQLGLASZAGSMO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |