C24H42HoNO- — CID 167482396
carbanide;1-[2-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone;holmium (PubChem CID 167482396) has the molecular formula C24H42HoNO- and a molecular weight of 525.54 g/mol. Its IUPAC name is carbanide;1-[2-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone;holmium.
| Compound Name | carbanide;1-[2-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone;holmium |
|---|---|
| PubChem CID | 167482396 |
| Molecular Formula | C24H42HoNO- |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | carbanide;1-[2-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone;holmium |
| SMILES | CC(=O)C1CCC2C3CCC4CCC(N(C)C)CC4(C)C3CCC12C.[CH3-].[Ho] |
| InChI | InChI=1S/C23H39NO.CH3.Ho/c1-15(25)19-10-11-20-18-9-7-16-6-8-17(24(4)5)14-23(16,3)21(18)12-13-22(19,20)2;;/h16-21H,6-14H2,1-5H3;1H3;/q;-1; |
| InChIKey | VXHDKQCNHKZEBI-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|