C22H22F3N5O2 — CID 167482560
N-[(4S)-3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 167482560) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is N-[(4S)-3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(4S)-3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167482560 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[(4S)-3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl)-3,4-dihydro-2H-chromen-4-yl]-6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc2c(N[C@H]3c4ccccc4OCC3N3CCC4OCCC43)ncnc2[nH]1 |
| InChI | InChI=1S/C22H22F3N5O2/c23-22(24,25)18-9-13-20(28-18)26-11-27-21(13)29-19-12-3-1-2-4-16(12)32-10-15(19)30-7-5-17-14(30)6-8-31-17/h1-4,9,11,14-15,17,19H,5-8,10H2,(H2,26,27,28,29)/t14?,15?,17?,19-/m0/s1 |
| InChIKey | QCGXUPQZMOLHTB-DIPZFXNXSA-N |
| XLogP | 3.75 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |