C25H25NO3 — CID 167482840
N-[(3R,4S)-3-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-4-yl]-1,1-diphenylmethanimine (PubChem CID 167482840) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[(3R,4S)-3-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-4-yl]-1,1-diphenylmethanimine.
| Compound Name | N-[(3R,4S)-3-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-4-yl]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 167482840 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[(3R,4S)-3-(2-methoxyethoxy)-3,4-dihydro-2H-chromen-4-yl]-1,1-diphenylmethanimine |
| SMILES | COCCO[C@H]1COc2ccccc2[C@@H]1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c1-27-16-17-28-23-18-29-22-15-9-8-14-21(22)25(23)26-24(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-15,23,25H,16-18H2,1H3/t23-,25-/m0/s1 |
| InChIKey | RSOAOWGMDJGJTF-ZCYQVOJMSA-N |
| XLogP | 4.69 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|