C11H16O2 — CID 167482885
3-ethoxy-3,4,7,8-tetrahydro-2H-chromene (PubChem CID 167482885) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-ethoxy-3,4,7,8-tetrahydro-2H-chromene.
| Compound Name | 3-ethoxy-3,4,7,8-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 167482885 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3-ethoxy-3,4,7,8-tetrahydro-2H-chromene |
| SMILES | CCOC1COC2=C(C=CCC2)C1 |
| InChI | InChI=1S/C11H16O2/c1-2-12-10-7-9-5-3-4-6-11(9)13-8-10/h3,5,10H,2,4,6-8H2,1H3 |
| InChIKey | KUCDOVRJLJVONR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |