About N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen
N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen (PubChem CID 167483138) has the molecular formula C18H17N3
and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen |
| PubChem CID | 167483138 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen |
| SMILES | [H][H].c1ccc2c(c1)CC/C2=N\Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H15N3.H2/c1-3-7-15-13(5-1)9-11-17(15)20-21-18-12-10-14-6-2-4-8-16(14)19-18;/h1-8,10,12H,9,11H2,(H,19,21);1H/b20-17+; |
| InChIKey | UIPJDLCMILFGCY-SJEOTZHBSA-N |
| XLogP | 4.24 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen?
The IUPAC name of N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen (CID 167483138) is N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen.
What is the SMILES notation for N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen?
The canonical SMILES for N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen is [H][H].c1ccc2c(c1)CC/C2=N\Nc1ccc2ccccc2n1.
What is the InChIKey of N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen?
The InChIKey is UIPJDLCMILFGCY-SJEOTZHBSA-N. The full InChI is InChI=1S/C18H15N3.H2/c1-3-7-15-13(5-1)9-11-17(15)20-21-18-12-10-14-6-2-4-8-16(14)19-18;/h1-8,10,12H,9,11H2,(H,19,21);1H/b20-17+;.
What are the key properties of N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen?
N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen has a molecular weight of 275.35 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2,3-dihydroinden-1-ylideneamino]quinolin-2-amine;molecular hydrogen is sourced from PubChem (CID 167483138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).