C19H15ClN6O2 — CID 167483619
(15R)-5-[(6-chloropyrimidin-4-yl)amino]-15-methyl-11-oxa-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 167483619) has the molecular formula C19H15ClN6O2 and a molecular weight of 394.82 g/mol. Its IUPAC name is (15R)-5-[(6-chloropyrimidin-4-yl)amino]-15-methyl-11-oxa-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-5-[(6-chloropyrimidin-4-yl)amino]-15-methyl-11-oxa-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 167483619 |
| Molecular Formula | C19H15ClN6O2 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (15R)-5-[(6-chloropyrimidin-4-yl)amino]-15-methyl-11-oxa-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C[C@@H]1CNc2c(oc3ccc4nc(Nc5cc(Cl)ncn5)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C19H15ClN6O2/c1-9-7-21-17-16-10-2-5-14(26-15-6-13(20)22-8-23-15)25-11(10)3-4-12(16)28-18(17)19(27)24-9/h2-6,8-9,21H,7H2,1H3,(H,24,27)(H,22,23,25,26)/t9-/m1/s1 |
| InChIKey | XUPPUAPSHSMKGR-SECBINFHSA-N |
| XLogP | 3.71 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |