C17H28 — CID 167483840
1-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropane;ethane (PubChem CID 167483840) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropane;ethane.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropane;ethane |
|---|---|
| PubChem CID | 167483840 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-1-[(3Z)-hexa-1,3,5-trien-2-yl]cyclopropane;ethane |
| SMILES | C=C/C=C\C(=C)C1(/C=C\C=C)CC1.CC.CC |
| InChI | InChI=1S/C13H16.2C2H6/c1-4-6-8-12(3)13(10-11-13)9-7-5-2;2*1-2/h4-9H,1-3,10-11H2;2*1-2H3/b8-6-,9-7-;; |
| InChIKey | BZFKOBAMXRYARY-SGBPTPMJSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|