C21H19FO4S2 — CID 16748421
[(2R)-1,1-bis(benzenesulfonyl)-1-fluoropropan-2-yl]benzene (PubChem CID 16748421) has the molecular formula C21H19FO4S2 and a molecular weight of 418.51 g/mol. Its IUPAC name is [(2R)-1,1-bis(benzenesulfonyl)-1-fluoropropan-2-yl]benzene.
| Compound Name | [(2R)-1,1-bis(benzenesulfonyl)-1-fluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 16748421 |
| Molecular Formula | C21H19FO4S2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [(2R)-1,1-bis(benzenesulfonyl)-1-fluoropropan-2-yl]benzene |
| SMILES | C[C@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19FO4S2/c1-17(18-11-5-2-6-12-18)21(22,27(23,24)19-13-7-3-8-14-19)28(25,26)20-15-9-4-10-16-20/h2-17H,1H3/t17-/m1/s1 |
| InChIKey | KGUVBCURXKXRGC-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |