C25H30 — CID 167484288
15-cyclohexa-1,5-dien-1-yl-9,9-dimethyltricyclo[8.5.0.02,8]pentadeca-1(10),2,4,7,11,14-hexaene;ethane (PubChem CID 167484288) has the molecular formula C25H30 and a molecular weight of 330.52 g/mol. Its IUPAC name is 15-cyclohexa-1,5-dien-1-yl-9,9-dimethyltricyclo[8.5.0.02,8]pentadeca-1(10),2,4,7,11,14-hexaene;ethane.
| Compound Name | 15-cyclohexa-1,5-dien-1-yl-9,9-dimethyltricyclo[8.5.0.02,8]pentadeca-1(10),2,4,7,11,14-hexaene;ethane |
|---|---|
| PubChem CID | 167484288 |
| Molecular Formula | C25H30 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 15-cyclohexa-1,5-dien-1-yl-9,9-dimethyltricyclo[8.5.0.02,8]pentadeca-1(10),2,4,7,11,14-hexaene;ethane |
| SMILES | CC.CC1(C)C2=CCC=CC=C2C2=C1C=CCC=C2C1=CCCC=C1 |
| InChI | InChI=1S/C23H24.C2H6/c1-23(2)20-15-8-4-7-14-19(20)22-18(13-9-10-16-21(22)23)17-11-5-3-6-12-17;1-2/h4-5,7,10-16H,3,6,8-9H2,1-2H3;1-2H3 |
| InChIKey | PWFUJSYPKOEGPI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |