C24H26ClNO2 — CID 167484654
(2Z,4Z)-3-chloro-1-[(2S)-2-[2-(3-methoxyphenyl)phenyl]pyrrolidin-1-yl]-2-methylhexa-2,4-dien-1-one (PubChem CID 167484654) has the molecular formula C24H26ClNO2 and a molecular weight of 395.93 g/mol. Its IUPAC name is (2Z,4Z)-3-chloro-1-[(2S)-2-[2-(3-methoxyphenyl)phenyl]pyrrolidin-1-yl]-2-methylhexa-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-3-chloro-1-[(2S)-2-[2-(3-methoxyphenyl)phenyl]pyrrolidin-1-yl]-2-methylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 167484654 |
| Molecular Formula | C24H26ClNO2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (2Z,4Z)-3-chloro-1-[(2S)-2-[2-(3-methoxyphenyl)phenyl]pyrrolidin-1-yl]-2-methylhexa-2,4-dien-1-one |
| SMILES | C/C=C\C(Cl)=C(/C)C(=O)N1CCC[C@H]1c1ccccc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C24H26ClNO2/c1-4-9-22(25)17(2)24(27)26-15-8-14-23(26)21-13-6-5-12-20(21)18-10-7-11-19(16-18)28-3/h4-7,9-13,16,23H,8,14-15H2,1-3H3/b9-4-,22-17-/t23-/m0/s1 |
| InChIKey | IDQNOEFCIDFPGB-JTGLHSOLSA-N |
| XLogP | 6.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|