C24H23FN4O2 — CID 16748529
N-[2-[6-(dimethylamino)-3-pyridinyl]propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide (PubChem CID 16748529) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is N-[2-[6-(dimethylamino)-3-pyridinyl]propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide.
| Compound Name | N-[2-[6-(dimethylamino)-3-pyridinyl]propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide |
|---|---|
| PubChem CID | 16748529 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[2-[6-(dimethylamino)-3-pyridinyl]propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(C)(C)NC(=O)c2cc3[nH]c4ccccc4c(=O)c3cc2F)cn1 |
| InChI | InChI=1S/C24H23FN4O2/c1-24(2,14-9-10-21(26-13-14)29(3)4)28-23(31)16-12-20-17(11-18(16)25)22(30)15-7-5-6-8-19(15)27-20/h5-13H,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | SQRHVAMQEULLBK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|