About 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole
3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole (PubChem CID 16748533) has the molecular formula C23H29NO4S
and a molecular weight of 415.56 g/mol. Its IUPAC name is 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole.
Molecular Properties
| Compound Name | 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole |
| PubChem CID | 16748533 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole |
| SMILES | CCOC(CCCc1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12)OCC |
| InChI | InChI=1S/C23H29NO4S/c1-4-27-23(28-5-2)12-8-9-19-17-24(22-11-7-6-10-21(19)22)29(25,26)20-15-13-18(3)14-16-20/h6-7,10-11,13-17,23H,4-5,8-9,12H2,1-3H3 |
| InChIKey | WGOSHFBSKBAGSS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole?
The IUPAC name of 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole (CID 16748533) is 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole.
What is the SMILES notation for 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole?
The canonical SMILES for 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole is CCOC(CCCc1cn(S(=O)(=O)c2ccc(C)cc2)c2ccccc12)OCC.
What is the InChIKey of 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole?
The InChIKey is WGOSHFBSKBAGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO4S/c1-4-27-23(28-5-2)12-8-9-19-17-24(22-11-7-6-10-21(19)22)29(25,26)20-15-13-18(3)14-16-20/h6-7,10-11,13-17,23H,4-5,8-9,12H2,1-3H3.
What are the key properties of 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole?
3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole has a molecular weight of 415.56 g/mol, XLogP of 4.91, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-diethoxybutyl)-1-(4-methylphenyl)sulfonylindole is sourced from PubChem (CID 16748533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).