C12H16O6 — CID 16748541
5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 16748541) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 16748541 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C[C@H]2COC(C)(C)O2)C(=O)O1 |
| InChI | InChI=1S/C12H16O6/c1-11(2)15-6-7(16-11)5-8-9(13)17-12(3,4)18-10(8)14/h5,7H,6H2,1-4H3/t7-/m0/s1 |
| InChIKey | NFDWPKXNBUTZIK-ZETCQYMHSA-N |
| XLogP | 0.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|