About 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine
4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine (PubChem CID 167485638) has the molecular formula C13H22FN3
and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine |
| PubChem CID | 167485638 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine |
| SMILES | NC1=NC=CC(N)(C2CCC(CCF)CC2)C1 |
| InChI | InChI=1S/C13H22FN3/c14-7-5-10-1-3-11(4-2-10)13(16)6-8-17-12(15)9-13/h6,8,10-11H,1-5,7,9,16H2,(H2,15,17) |
| InChIKey | TXOPMOUARJQDQR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine?
The IUPAC name of 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine (CID 167485638) is 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine.
What is the SMILES notation for 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine?
The canonical SMILES for 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine is NC1=NC=CC(N)(C2CCC(CCF)CC2)C1.
What is the InChIKey of 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine?
The InChIKey is TXOPMOUARJQDQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22FN3/c14-7-5-10-1-3-11(4-2-10)13(16)6-8-17-12(15)9-13/h6,8,10-11H,1-5,7,9,16H2,(H2,15,17).
What are the key properties of 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine?
4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine has a molecular weight of 239.34 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-fluoroethyl)cyclohexyl]-3H-pyridine-2,4-diamine is sourced from PubChem (CID 167485638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).