C22H20FN5O3 — CID 167486253
N-[5-[3-(5-fluoro-6-methyl-3-pyridinyl)-2-methoxyanilino]-6-formylpyridazin-3-yl]cyclopropanecarboxamide (PubChem CID 167486253) has the molecular formula C22H20FN5O3 and a molecular weight of 421.43 g/mol. Its IUPAC name is N-[5-[3-(5-fluoro-6-methyl-3-pyridinyl)-2-methoxyanilino]-6-formylpyridazin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[3-(5-fluoro-6-methyl-3-pyridinyl)-2-methoxyanilino]-6-formylpyridazin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167486253 |
| Molecular Formula | C22H20FN5O3 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[5-[3-(5-fluoro-6-methyl-3-pyridinyl)-2-methoxyanilino]-6-formylpyridazin-3-yl]cyclopropanecarboxamide |
| SMILES | COc1c(Nc2cc(NC(=O)C3CC3)nnc2C=O)cccc1-c1cnc(C)c(F)c1 |
| InChI | InChI=1S/C22H20FN5O3/c1-12-16(23)8-14(10-24-12)15-4-3-5-17(21(15)31-2)25-18-9-20(28-27-19(18)11-29)26-22(30)13-6-7-13/h3-5,8-11,13H,6-7H2,1-2H3,(H2,25,26,28,30) |
| InChIKey | ITIDFPYGDQJRRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|