C12H22N2 — CID 167486385
(2Z)-8-methyl-3-propan-2-yl-1,6,7,8,9,10-hexahydro-1,4-diazecine (PubChem CID 167486385) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (2Z)-8-methyl-3-propan-2-yl-1,6,7,8,9,10-hexahydro-1,4-diazecine.
| Compound Name | (2Z)-8-methyl-3-propan-2-yl-1,6,7,8,9,10-hexahydro-1,4-diazecine |
|---|---|
| PubChem CID | 167486385 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (2Z)-8-methyl-3-propan-2-yl-1,6,7,8,9,10-hexahydro-1,4-diazecine |
| SMILES | CC1CC/C=N/C(C(C)C)=C\NCC1 |
| InChI | InChI=1S/C12H22N2/c1-10(2)12-9-13-8-6-11(3)5-4-7-14-12/h7,9-11,13H,4-6,8H2,1-3H3/b12-9-,14-7+ |
| InChIKey | FMYYOVNKTVKPIP-AAVCTYAVSA-N |
| XLogP | 2.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |