About 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane
1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane (PubChem CID 167486425) has the molecular formula C18H32FNO
and a molecular weight of 297.46 g/mol. Its IUPAC name is 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane.
Molecular Properties
| Compound Name | 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane |
| PubChem CID | 167486425 |
| Molecular Formula | C18H32FNO |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane |
| SMILES | CCC.CCC(C)(F)CC.CCc1cccc(C(C)=O)n1 |
| InChI | InChI=1S/C9H11NO.C6H13F.C3H8/c1-3-8-5-4-6-9(10-8)7(2)11;1-4-6(3,7)5-2;1-3-2/h4-6H,3H2,1-2H3;4-5H2,1-3H3;3H2,1-2H3 |
| InChIKey | LFLRQIMRKRRHAF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane?
The IUPAC name of 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane (CID 167486425) is 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane.
What is the SMILES notation for 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane?
The canonical SMILES for 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane is CCC.CCC(C)(F)CC.CCc1cccc(C(C)=O)n1.
What is the InChIKey of 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane?
The InChIKey is LFLRQIMRKRRHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C6H13F.C3H8/c1-3-8-5-4-6-9(10-8)7(2)11;1-4-6(3,7)5-2;1-3-2/h4-6H,3H2,1-2H3;4-5H2,1-3H3;3H2,1-2H3.
What are the key properties of 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane?
1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane has a molecular weight of 297.46 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-ethyl-2-pyridinyl)ethanone;3-fluoro-3-methylpentane;propane is sourced from PubChem (CID 167486425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).