C23H31N3O5 — CID 16748677
ethyl 4-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 16748677) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 4-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | ethyl 4-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 16748677 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | ethyl 4-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2noc([C@H](CCCC3CCCCC3)CC(=O)NO)n2)cc1 |
| InChI | InChI=1S/C23H31N3O5/c1-2-30-23(28)18-13-11-17(12-14-18)21-24-22(31-26-21)19(15-20(27)25-29)10-6-9-16-7-4-3-5-8-16/h11-14,16,19,29H,2-10,15H2,1H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | XGKFVXQNSHFPNO-LJQANCHMSA-N |
| XLogP | 4.64 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|