C21H30N4O5S — CID 16748680
(3R)-6-cyclohexyl-N-hydroxy-3-[3-[4-(methanesulfonamido)phenyl]-1,2,4-oxadiazol-5-yl]hexanamide (PubChem CID 16748680) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is (3R)-6-cyclohexyl-N-hydroxy-3-[3-[4-(methanesulfonamido)phenyl]-1,2,4-oxadiazol-5-yl]hexanamide.
| Compound Name | (3R)-6-cyclohexyl-N-hydroxy-3-[3-[4-(methanesulfonamido)phenyl]-1,2,4-oxadiazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 16748680 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (3R)-6-cyclohexyl-N-hydroxy-3-[3-[4-(methanesulfonamido)phenyl]-1,2,4-oxadiazol-5-yl]hexanamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2noc([C@H](CCCC3CCCCC3)CC(=O)NO)n2)cc1 |
| InChI | InChI=1S/C21H30N4O5S/c1-31(28,29)25-18-12-10-16(11-13-18)20-22-21(30-24-20)17(14-19(26)23-27)9-5-8-15-6-3-2-4-7-15/h10-13,15,17,25,27H,2-9,14H2,1H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | CSYVKNCZXAFYBA-QGZVFWFLSA-N |
| XLogP | 3.84 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|