C28H31N5O4 — CID 167487737
tert-butyl 5-[[7-methoxy-6-(1-prop-2-enoylazetidin-3-yl)quinazolin-4-yl]amino]-2,3-dihydroindole-1-carboxylate (PubChem CID 167487737) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is tert-butyl 5-[[7-methoxy-6-(1-prop-2-enoylazetidin-3-yl)quinazolin-4-yl]amino]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-[[7-methoxy-6-(1-prop-2-enoylazetidin-3-yl)quinazolin-4-yl]amino]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 167487737 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl 5-[[7-methoxy-6-(1-prop-2-enoylazetidin-3-yl)quinazolin-4-yl]amino]-2,3-dihydroindole-1-carboxylate |
| SMILES | C=CC(=O)N1CC(c2cc3c(Nc4ccc5c(c4)CCN5C(=O)OC(C)(C)C)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C28H31N5O4/c1-6-25(34)32-14-18(15-32)20-12-21-22(13-24(20)36-5)29-16-30-26(21)31-19-7-8-23-17(11-19)9-10-33(23)27(35)37-28(2,3)4/h6-8,11-13,16,18H,1,9-10,14-15H2,2-5H3,(H,29,30,31) |
| InChIKey | SYCULAOVRWVXAB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|