C27H22Cl2O5 — CID 16748779
methyl (E)-2-[2-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate (PubChem CID 16748779) has the molecular formula C27H22Cl2O5 and a molecular weight of 497.37 g/mol. Its IUPAC name is methyl (E)-2-[2-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[2-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 16748779 |
| Molecular Formula | C27H22Cl2O5 |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | methyl (E)-2-[2-[[4-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]phenoxy]methyl]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1ccc(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H22Cl2O5/c1-32-17-23(27(31)33-2)22-6-4-3-5-20(22)16-34-21-11-9-19(10-12-21)26(30)14-8-18-7-13-24(28)25(29)15-18/h3-15,17H,16H2,1-2H3/b14-8+,23-17+ |
| InChIKey | FPWJCTXKVJBDSP-ARFKPPEXSA-N |
| XLogP | 6.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|