C19H27N5O3 — CID 16748896
(3R)-3-[3-(6-amino-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide (PubChem CID 16748896) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is (3R)-3-[3-(6-amino-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide.
| Compound Name | (3R)-3-[3-(6-amino-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 16748896 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (3R)-3-[3-(6-amino-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
| SMILES | Nc1ccc(-c2noc([C@H](CCCC3CCCCC3)CC(=O)NO)n2)cn1 |
| InChI | InChI=1S/C19H27N5O3/c20-16-10-9-15(12-21-16)18-22-19(27-24-18)14(11-17(25)23-26)8-4-7-13-5-2-1-3-6-13/h9-10,12-14,26H,1-8,11H2,(H2,20,21)(H,23,25)/t14-/m1/s1 |
| InChIKey | BSZZTCBCDSTIJT-CQSZACIVSA-N |
| XLogP | 3.44 |
| TPSA | 127.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|