C23H23NO5 — CID 16748947
1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 16748947) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 16748947 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc2c(CN3CCC(C(=O)O)CC3)cc3cc4c(cc3c2c1)OCO4 |
| InChI | InChI=1S/C23H23NO5/c1-27-17-2-3-18-16(12-24-6-4-14(5-7-24)23(25)26)8-15-9-21-22(29-13-28-21)11-19(15)20(18)10-17/h2-3,8-11,14H,4-7,12-13H2,1H3,(H,25,26) |
| InChIKey | BXDITWFRCRAMCI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|