C16H23F3N4OS — CID 167489684
(Z)-2-[amino(methyl)amino]-1-[6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine (PubChem CID 167489684) has the molecular formula C16H23F3N4OS and a molecular weight of 376.45 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-[6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-[6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine |
|---|---|
| PubChem CID | 167489684 |
| Molecular Formula | C16H23F3N4OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-[6'-methyl-2-(trifluoromethyl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]ethenamine |
| SMILES | CC1CC2(CC(/C(N)=C/N(C)N)N1)OCCc1cc(C(F)(F)F)sc12 |
| InChI | InChI=1S/C16H23F3N4OS/c1-9-6-15(7-12(22-9)11(20)8-23(2)21)14-10(3-4-24-15)5-13(25-14)16(17,18)19/h5,8-9,12,22H,3-4,6-7,20-21H2,1-2H3/b11-8- |
| InChIKey | TVJSWRRRDKDYLJ-FLIBITNWSA-N |
| XLogP | 2.28 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|