C17H20F6N4O3S — CID 167489712
(Z)-2-[amino(methyl)amino]ethenamine;1-(2,2,2-trifluoroacetyl)-2'-(trifluoromethyl)spiro[piperidine-4,7'-thieno[2,3-c]pyran]-4'-one (PubChem CID 167489712) has the molecular formula C17H20F6N4O3S and a molecular weight of 474.43 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]ethenamine;1-(2,2,2-trifluoroacetyl)-2'-(trifluoromethyl)spiro[piperidine-4,7'-thieno[2,3-c]pyran]-4'-one.
| Compound Name | (Z)-2-[amino(methyl)amino]ethenamine;1-(2,2,2-trifluoroacetyl)-2'-(trifluoromethyl)spiro[piperidine-4,7'-thieno[2,3-c]pyran]-4'-one |
|---|---|
| PubChem CID | 167489712 |
| Molecular Formula | C17H20F6N4O3S |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]ethenamine;1-(2,2,2-trifluoroacetyl)-2'-(trifluoromethyl)spiro[piperidine-4,7'-thieno[2,3-c]pyran]-4'-one |
| SMILES | CN(N)/C=C\N.O=C1COC2(CCN(C(=O)C(F)(F)F)CC2)c2sc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H11F6NO3S.C3H9N3/c15-13(16,17)9-5-7-8(22)6-24-12(10(7)25-9)1-3-21(4-2-12)11(23)14(18,19)20;1-6(5)3-2-4/h5H,1-4,6H2;2-3H,4-5H2,1H3/b;3-2- |
| InChIKey | ZFOWOEWKNPNGMA-AHNKWOMYSA-N |
| XLogP | 2.58 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|