C12H13Cl2NS2 — CID 167489813
5-(3,4-dichlorophenyl)-4-propan-2-yl-2,3-dihydro-1,3-thiazole-2-thiol (PubChem CID 167489813) has the molecular formula C12H13Cl2NS2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-4-propan-2-yl-2,3-dihydro-1,3-thiazole-2-thiol.
| Compound Name | 5-(3,4-dichlorophenyl)-4-propan-2-yl-2,3-dihydro-1,3-thiazole-2-thiol |
|---|---|
| PubChem CID | 167489813 |
| Molecular Formula | C12H13Cl2NS2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-4-propan-2-yl-2,3-dihydro-1,3-thiazole-2-thiol |
| SMILES | CC(C)C1=C(c2ccc(Cl)c(Cl)c2)SC(S)N1 |
| InChI | InChI=1S/C12H13Cl2NS2/c1-6(2)10-11(17-12(16)15-10)7-3-4-8(13)9(14)5-7/h3-6,12,15-16H,1-2H3 |
| InChIKey | UTVVMZOABWFXGR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|