C21H19BN6O3 — CID 167490859
CID 167490859 (PubChem CID 167490859) has the molecular formula C21H19BN6O3 and a molecular weight of 414.23 g/mol.
| Compound Name | CID 167490859 |
|---|---|
| PubChem CID | 167490859 |
| Molecular Formula | C21H19BN6O3 |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | — |
| SMILES | [B]c1cncc(NC(=O)[C@@H]2C[C@H]3CC3N2C(=O)Cn2nc(C(C)=O)c3ccccc32)n1 |
| InChI | InChI=1S/C21H19BN6O3/c1-11(29)20-13-4-2-3-5-14(13)27(26-20)10-19(30)28-15-6-12(15)7-16(28)21(31)25-18-9-23-8-17(22)24-18/h2-5,8-9,12,15-16H,6-7,10H2,1H3,(H,24,25,31)/t12-,15?,16+/m1/s1 |
| InChIKey | CHQLNYZDCFZHDZ-TYVLWQRCSA-N |
| XLogP | 0.45 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|