About ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine
ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine (PubChem CID 167492727) has the molecular formula C19H20F3N3
and a molecular weight of 347.38 g/mol. Its IUPAC name is ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine.
Molecular Properties
| Compound Name | ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine |
| PubChem CID | 167492727 |
| Molecular Formula | C19H20F3N3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine |
| SMILES | CC.Cc1cc(C(F)(F)F)ccc1C1=NCC=C(N)c2cnccc21 |
| InChI | InChI=1S/C17H14F3N3.C2H6/c1-10-8-11(17(18,19)20)2-3-12(10)16-13-4-6-22-9-14(13)15(21)5-7-23-16;1-2/h2-6,8-9H,7,21H2,1H3;1-2H3 |
| InChIKey | RDBCCJRFTIHJDO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine?
The IUPAC name of ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine (CID 167492727) is ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine.
What is the SMILES notation for ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine?
The canonical SMILES for ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine is CC.Cc1cc(C(F)(F)F)ccc1C1=NCC=C(N)c2cnccc21.
What is the InChIKey of ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine?
The InChIKey is RDBCCJRFTIHJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N3.C2H6/c1-10-8-11(17(18,19)20)2-3-12(10)16-13-4-6-22-9-14(13)15(21)5-7-23-16;1-2/h2-6,8-9H,7,21H2,1H3;1-2H3.
What are the key properties of ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine?
ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine has a molecular weight of 347.38 g/mol, XLogP of 4.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-[2-methyl-4-(trifluoromethyl)phenyl]-7H-pyrido[4,3-c]azepin-9-amine is sourced from PubChem (CID 167492727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).