C16H26O6 — CID 16749286
[(1S,2S,5S)-6,6-diethoxy-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 16749286) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(1S,2S,5S)-6,6-diethoxy-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,2S,5S)-6,6-diethoxy-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 16749286 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [(1S,2S,5S)-6,6-diethoxy-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCOC1(OCC)C[C@@H]2[C@@H](COC(=O)C(C)(C)C)OC(=O)[C@@H]21 |
| InChI | InChI=1S/C16H26O6/c1-6-20-16(21-7-2)8-10-11(22-13(17)12(10)16)9-19-14(18)15(3,4)5/h10-12H,6-9H2,1-5H3/t10-,11-,12-/m1/s1 |
| InChIKey | OCAXPHZVYOKDFL-IJLUTSLNSA-N |
| XLogP | 1.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|