C32H51F4N2U- — CID 167492920
(E)-1-N-[(2E,4Z)-1-(2-fluoro-4-methylbenzene-6-id-1-yl)-2-methylhepta-2,4-dienyl]-1-N-methyl-3-N-(2-methyloctan-4-yl)but-2-ene-1,3-diamine;1,1,1-trifluoropropane;uranium (PubChem CID 167492920) has the molecular formula C32H51F4N2U- and a molecular weight of 777.79 g/mol. Its IUPAC name is (E)-1-N-[(2E,4Z)-1-(2-fluoro-4-methylbenzene-6-id-1-yl)-2-methylhepta-2,4-dienyl]-1-N-methyl-3-N-(2-methyloctan-4-yl)but-2-ene-1,3-diamine;1,1,1-trifluoropropane;uranium.
| Compound Name | (E)-1-N-[(2E,4Z)-1-(2-fluoro-4-methylbenzene-6-id-1-yl)-2-methylhepta-2,4-dienyl]-1-N-methyl-3-N-(2-methyloctan-4-yl)but-2-ene-1,3-diamine;1,1,1-trifluoropropane;uranium |
|---|---|
| PubChem CID | 167492920 |
| Molecular Formula | C32H51F4N2U- |
| Molecular Weight | 777.79 g/mol |
| Exact Mass | 777.45 |
| IUPAC Name | (E)-1-N-[(2E,4Z)-1-(2-fluoro-4-methylbenzene-6-id-1-yl)-2-methylhepta-2,4-dienyl]-1-N-methyl-3-N-(2-methyloctan-4-yl)but-2-ene-1,3-diamine;1,1,1-trifluoropropane;uranium |
| SMILES | CC/C=C\C=C(/C)C(c1[c-]cc(C)cc1F)N(C)C/C=C(\C)NC(CCCC)CC(C)C.CCC(F)(F)F.[U] |
| InChI | InChI=1S/C29H46FN2.C3H5F3.U/c1-9-11-13-14-24(6)29(27-17-16-23(5)21-28(27)30)32(8)19-18-25(7)31-26(15-12-10-2)20-22(3)4;1-2-3(4,5)6;/h11,13-14,16,18,21-22,26,29,31H,9-10,12,15,19-20H2,1-8H3;2H2,1H3;/q-1;;/b13-11-,24-14+,25-18+;; |
| InChIKey | VEUQYUMTBWPWMY-JVYYXVSQSA-N |
| XLogP | 9.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.79 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|