About 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea
1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 16749351) has the molecular formula C21H23F2N5O
and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea |
| PubChem CID | 16749351 |
| Molecular Formula | C21H23F2N5O |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | O=C(NCc1cc(F)c(N2CCCCCC2)c(F)c1)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C21H23F2N5O/c22-16-10-14(11-17(23)20(16)28-8-3-1-2-4-9-28)12-24-21(29)26-18-6-5-7-19-15(18)13-25-27-19/h5-7,10-11,13H,1-4,8-9,12H2,(H,25,27)(H2,24,26,29) |
| InChIKey | HSMAOWOUKFTCGP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea?
The IUPAC name of 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea (CID 16749351) is 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea.
What is the SMILES notation for 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea?
The canonical SMILES for 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea is O=C(NCc1cc(F)c(N2CCCCCC2)c(F)c1)Nc1cccc2[nH]ncc12.
What is the InChIKey of 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea?
The InChIKey is HSMAOWOUKFTCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F2N5O/c22-16-10-14(11-17(23)20(16)28-8-3-1-2-4-9-28)12-24-21(29)26-18-6-5-7-19-15(18)13-25-27-19/h5-7,10-11,13H,1-4,8-9,12H2,(H,25,27)(H2,24,26,29).
What are the key properties of 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea?
1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea has a molecular weight of 399.45 g/mol, XLogP of 4.54, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(azepan-1-yl)-3,5-difluorophenyl]methyl]-3-(1H-indazol-4-yl)urea is sourced from PubChem (CID 16749351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).