About 3-fluoro-1-methylsulfinylpyrrolidine;methanamine
3-fluoro-1-methylsulfinylpyrrolidine;methanamine (PubChem CID 167493542) has the molecular formula C6H15FN2OS
and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-fluoro-1-methylsulfinylpyrrolidine;methanamine.
Molecular Properties
| Compound Name | 3-fluoro-1-methylsulfinylpyrrolidine;methanamine |
| PubChem CID | 167493542 |
| Molecular Formula | C6H15FN2OS |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-fluoro-1-methylsulfinylpyrrolidine;methanamine |
| SMILES | CN.CS(=O)N1CCC(F)C1 |
| InChI | InChI=1S/C5H10FNOS.CH5N/c1-9(8)7-3-2-5(6)4-7;1-2/h5H,2-4H2,1H3;2H2,1H3 |
| InChIKey | IOQAMNIPTOUEPJ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1-methylsulfinylpyrrolidine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-methylsulfinylpyrrolidine;methanamine?
The IUPAC name of 3-fluoro-1-methylsulfinylpyrrolidine;methanamine (CID 167493542) is 3-fluoro-1-methylsulfinylpyrrolidine;methanamine.
What is the SMILES notation for 3-fluoro-1-methylsulfinylpyrrolidine;methanamine?
The canonical SMILES for 3-fluoro-1-methylsulfinylpyrrolidine;methanamine is CN.CS(=O)N1CCC(F)C1.
What is the InChIKey of 3-fluoro-1-methylsulfinylpyrrolidine;methanamine?
The InChIKey is IOQAMNIPTOUEPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNOS.CH5N/c1-9(8)7-3-2-5(6)4-7;1-2/h5H,2-4H2,1H3;2H2,1H3.
What are the key properties of 3-fluoro-1-methylsulfinylpyrrolidine;methanamine?
3-fluoro-1-methylsulfinylpyrrolidine;methanamine has a molecular weight of 182.26 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-methylsulfinylpyrrolidine;methanamine is sourced from PubChem (CID 167493542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).