About methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate
methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate (PubChem CID 167493545) has the molecular formula C13H16F2N2O2
and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate |
| PubChem CID | 167493545 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CN2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-19-12(18)11-4-2-3-10(16-11)9-17-7-5-13(14,15)6-8-17/h2-4H,5-9H2,1H3 |
| InChIKey | FZIPGBJYYQTVPR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate (CID 167493545) is methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate is COC(=O)c1cccc(CN2CCC(F)(F)CC2)n1.
What is the InChIKey of methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate?
The InChIKey is FZIPGBJYYQTVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O2/c1-19-12(18)11-4-2-3-10(16-11)9-17-7-5-13(14,15)6-8-17/h2-4H,5-9H2,1H3.
What are the key properties of methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate?
methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate has a molecular weight of 270.28 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(4,4-difluoropiperidin-1-yl)methyl]pyridine-2-carboxylate is sourced from PubChem (CID 167493545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).