C5H10F2N2O2S — CID 167493650
1,1-difluoro-3-methyl-3-(sulfamoylamino)cyclobutane (PubChem CID 167493650) has the molecular formula C5H10F2N2O2S and a molecular weight of 200.21 g/mol. Its IUPAC name is 1,1-difluoro-3-methyl-3-(sulfamoylamino)cyclobutane.
| Compound Name | 1,1-difluoro-3-methyl-3-(sulfamoylamino)cyclobutane |
|---|---|
| PubChem CID | 167493650 |
| Molecular Formula | C5H10F2N2O2S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,1-difluoro-3-methyl-3-(sulfamoylamino)cyclobutane |
| SMILES | CC1(NS(N)(=O)=O)CC(F)(F)C1 |
| InChI | InChI=1S/C5H10F2N2O2S/c1-4(9-12(8,10)11)2-5(6,7)3-4/h9H,2-3H2,1H3,(H2,8,10,11) |
| InChIKey | PDQHMDALAKFGOU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |