About CID 167493827
CID 167493827 (PubChem CID 167493827) has the molecular formula C28H35N3O4S
and a molecular weight of 509.67 g/mol.
Molecular Properties
| Compound Name | CID 167493827 |
| PubChem CID | 167493827 |
| Molecular Formula | C28H35N3O4S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1ccnc([C@H](O)C2CCCC2)c1 |
| InChI | InChI=1S/C28H35N3O4S/c1-36(34,35)30-21-6-7-24-22(17-21)28(13-11-27(9-10-27)12-14-28)18-31(24)26(33)20-8-15-29-23(16-20)25(32)19-4-2-3-5-19/h6-8,15-17,19,25,30,32H,2-5,9-14,18H2,1H3/t25-/m1/s1 |
| InChIKey | CADOTQCNBWUGFM-RUZDIDTESA-N |
| XLogP | 4.93 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 167493827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167493827?
The IUPAC name of CID 167493827 (CID 167493827) is not available.
What is the SMILES notation for CID 167493827?
The canonical SMILES for CID 167493827 is CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1ccnc([C@H](O)C2CCCC2)c1.
What is the InChIKey of CID 167493827?
The InChIKey is CADOTQCNBWUGFM-RUZDIDTESA-N. The full InChI is InChI=1S/C28H35N3O4S/c1-36(34,35)30-21-6-7-24-22(17-21)28(13-11-27(9-10-27)12-14-28)18-31(24)26(33)20-8-15-29-23(16-20)25(32)19-4-2-3-5-19/h6-8,15-17,19,25,30,32H,2-5,9-14,18H2,1H3/t25-/m1/s1.
What are the key properties of CID 167493827?
CID 167493827 has a molecular weight of 509.67 g/mol, XLogP of 4.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167493827 is sourced from PubChem (CID 167493827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).