About CID 167493991
CID 167493991 (PubChem CID 167493991) has the molecular formula C28H35N3O4S
and a molecular weight of 509.67 g/mol.
Molecular Properties
| Compound Name | CID 167493991 |
| PubChem CID | 167493991 |
| Molecular Formula | C28H35N3O4S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1ccnc([C@@H](O)C2CCCC2)c1 |
| InChI | InChI=1S/C28H35N3O4S/c1-36(34,35)30-21-6-7-24-22(17-21)28(13-11-27(9-10-27)12-14-28)18-31(24)26(33)20-8-15-29-23(16-20)25(32)19-4-2-3-5-19/h6-8,15-17,19,25,30,32H,2-5,9-14,18H2,1H3/t25-/m0/s1 |
| InChIKey | CADOTQCNBWUGFM-VWLOTQADSA-N |
| XLogP | 4.93 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 167493991 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167493991?
The IUPAC name of CID 167493991 (CID 167493991) is not available.
What is the SMILES notation for CID 167493991?
The canonical SMILES for CID 167493991 is CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1ccnc([C@@H](O)C2CCCC2)c1.
What is the InChIKey of CID 167493991?
The InChIKey is CADOTQCNBWUGFM-VWLOTQADSA-N. The full InChI is InChI=1S/C28H35N3O4S/c1-36(34,35)30-21-6-7-24-22(17-21)28(13-11-27(9-10-27)12-14-28)18-31(24)26(33)20-8-15-29-23(16-20)25(32)19-4-2-3-5-19/h6-8,15-17,19,25,30,32H,2-5,9-14,18H2,1H3/t25-/m0/s1.
What are the key properties of CID 167493991?
CID 167493991 has a molecular weight of 509.67 g/mol, XLogP of 4.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167493991 is sourced from PubChem (CID 167493991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).