About N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane
N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane (PubChem CID 167494082) has the molecular formula C8H17F2NOS
and a molecular weight of 213.29 g/mol. Its IUPAC name is N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane.
Molecular Properties
| Compound Name | N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane |
| PubChem CID | 167494082 |
| Molecular Formula | C8H17F2NOS |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane |
| SMILES | CC.CS(=O)NC1(C)CC(F)(F)C1 |
| InChI | InChI=1S/C6H11F2NOS.C2H6/c1-5(9-11(2)10)3-6(7,8)4-5;1-2/h9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | JBNRBAHTQVBDCU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane?
The IUPAC name of N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane (CID 167494082) is N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane.
What is the SMILES notation for N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane?
The canonical SMILES for N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane is CC.CS(=O)NC1(C)CC(F)(F)C1.
What is the InChIKey of N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane?
The InChIKey is JBNRBAHTQVBDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NOS.C2H6/c1-5(9-11(2)10)3-6(7,8)4-5;1-2/h9H,3-4H2,1-2H3;1-2H3.
What are the key properties of N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane?
N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane has a molecular weight of 213.29 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoro-1-methylcyclobutyl)methanesulfinamide;ethane is sourced from PubChem (CID 167494082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).