About ethane;2-methylpropane;yttrium
ethane;2-methylpropane;yttrium (PubChem CID 167494260) has the molecular formula C6H15Y-
and a molecular weight of 176.09 g/mol. Its IUPAC name is ethane;2-methylpropane;yttrium.
Molecular Properties
| Compound Name | ethane;2-methylpropane;yttrium |
| PubChem CID | 167494260 |
| Molecular Formula | C6H15Y- |
| Molecular Weight | 176.09 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | ethane;2-methylpropane;yttrium |
| SMILES | CC.C[C-](C)C.[Y] |
| InChI | InChI=1S/C4H9.C2H6.Y/c1-4(2)3;1-2;/h1-3H3;1-2H3;/q-1;; |
| InChIKey | ZPSUCCFLQRGTHX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylpropane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;yttrium?
The IUPAC name of ethane;2-methylpropane;yttrium (CID 167494260) is ethane;2-methylpropane;yttrium.
What is the SMILES notation for ethane;2-methylpropane;yttrium?
The canonical SMILES for ethane;2-methylpropane;yttrium is CC.C[C-](C)C.[Y].
What is the InChIKey of ethane;2-methylpropane;yttrium?
The InChIKey is ZPSUCCFLQRGTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.C2H6.Y/c1-4(2)3;1-2;/h1-3H3;1-2H3;/q-1;;.
What are the key properties of ethane;2-methylpropane;yttrium?
ethane;2-methylpropane;yttrium has a molecular weight of 176.09 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;yttrium is sourced from PubChem (CID 167494260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).