C18H33NO3Si — CID 167494824
ethyl 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine-8-carboxylate (PubChem CID 167494824) has the molecular formula C18H33NO3Si and a molecular weight of 339.55 g/mol. Its IUPAC name is ethyl 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
| Compound Name | ethyl 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 167494824 |
| Molecular Formula | C18H33NO3Si |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | ethyl 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| SMILES | C=C1CN2CCC(CO[Si](C)(C)C(C)(C)C)C2(C(=O)OCC)C1 |
| InChI | InChI=1S/C18H33NO3Si/c1-8-21-16(20)18-11-14(2)12-19(18)10-9-15(18)13-22-23(6,7)17(3,4)5/h15H,2,8-13H2,1,3-7H3 |
| InChIKey | ZVQFNIDDZNZCCU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|