C15H27NO2Si — CID 167494831
(8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-1,2,5,7-tetrahydropyrrolizin-3-one (PubChem CID 167494831) has the molecular formula C15H27NO2Si and a molecular weight of 281.47 g/mol. Its IUPAC name is (8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-1,2,5,7-tetrahydropyrrolizin-3-one.
| Compound Name | (8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-1,2,5,7-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 167494831 |
| Molecular Formula | C15H27NO2Si |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methylidene-1,2,5,7-tetrahydropyrrolizin-3-one |
| SMILES | C=C1CN2C(=O)CC[C@@]2(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27NO2Si/c1-12-9-15(8-7-13(17)16(15)10-12)11-18-19(5,6)14(2,3)4/h1,7-11H2,2-6H3/t15-/m0/s1 |
| InChIKey | DWRFXPYYHAMGQG-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|