C23H29ClFN5O4S — CID 167494845
tert-butyl (1S,2S,5R)-2-[(S)-(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy-cyclopropylmethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 167494845) has the molecular formula C23H29ClFN5O4S and a molecular weight of 526.03 g/mol. Its IUPAC name is tert-butyl (1S,2S,5R)-2-[(S)-(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy-cyclopropylmethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1S,2S,5R)-2-[(S)-(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy-cyclopropylmethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 167494845 |
| Molecular Formula | C23H29ClFN5O4S |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | tert-butyl (1S,2S,5R)-2-[(S)-(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy-cyclopropylmethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CSc1nc2c(F)c(Cl)nc(O[C@@H](C3CC3)[C@H]3NC[C@H]4CC[C@@H]3N4C(=O)OC(C)(C)C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C23H29ClFN5O4S/c1-23(2,3)34-22(32)30-11-7-8-12(30)15(26-9-11)17(10-5-6-10)33-20-13-16(14(25)18(24)28-20)27-21(35-4)29-19(13)31/h10-12,15,17,26H,5-9H2,1-4H3,(H,27,29,31)/t11-,12+,15+,17+/m1/s1 |
| InChIKey | NAUOPFRCOIPELW-LMMLAZSQSA-N |
| XLogP | 3.73 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|