C21H25ClF3N5O4S — CID 167494892
tert-butyl (1R,2S,5S)-2-[(1S)-1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2-difluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 167494892) has the molecular formula C21H25ClF3N5O4S and a molecular weight of 535.98 g/mol. Its IUPAC name is tert-butyl (1R,2S,5S)-2-[(1S)-1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2-difluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (1R,2S,5S)-2-[(1S)-1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2-difluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 167494892 |
| Molecular Formula | C21H25ClF3N5O4S |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | tert-butyl (1R,2S,5S)-2-[(1S)-1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2-difluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CSc1nc2c(F)c(Cl)nc(O[C@H](C(F)F)[C@H]3NC[C@@H]4CC[C@H]3N4C(=O)OC(C)(C)C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C21H25ClF3N5O4S/c1-21(2,3)34-20(32)30-8-5-6-9(30)12(26-7-8)14(16(24)25)33-18-10-13(11(23)15(22)28-18)27-19(35-4)29-17(10)31/h8-9,12,14,16,26H,5-7H2,1-4H3,(H,27,29,31)/t8-,9+,12-,14-/m0/s1 |
| InChIKey | GDZHJFLNTUMODT-NVVZYBJKSA-N |
| XLogP | 3.58 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|