C14H18ClN3O2 — CID 167495014
2-chloro-3-formyl-N,N-dimethyl-6-[(2R)-2-methylpyrrolidin-1-yl]pyridine-4-carboxamide (PubChem CID 167495014) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-chloro-3-formyl-N,N-dimethyl-6-[(2R)-2-methylpyrrolidin-1-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-3-formyl-N,N-dimethyl-6-[(2R)-2-methylpyrrolidin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167495014 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-chloro-3-formyl-N,N-dimethyl-6-[(2R)-2-methylpyrrolidin-1-yl]pyridine-4-carboxamide |
| SMILES | C[C@@H]1CCCN1c1cc(C(=O)N(C)C)c(C=O)c(Cl)n1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-9-5-4-6-18(9)12-7-10(14(20)17(2)3)11(8-19)13(15)16-12/h7-9H,4-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | DHFMFQYOCIFQDM-SECBINFHSA-N |
| XLogP | 2.24 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|