C30H30ClFN2O6 — CID 167495447
N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]morpholine-4-carboxamide (PubChem CID 167495447) has the molecular formula C30H30ClFN2O6 and a molecular weight of 569.03 g/mol. Its IUPAC name is N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]morpholine-4-carboxamide.
| Compound Name | N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 167495447 |
| Molecular Formula | C30H30ClFN2O6 |
| Molecular Weight | 569.03 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]morpholine-4-carboxamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Cl)cc3)[C@H](c3cccc(F)c3)C[C@H](NC(=O)N3CCOCC3)[C@@]21O |
| InChI | InChI=1S/C30H30ClFN2O6/c1-37-22-15-24(38-2)27-25(16-22)40-30(19-6-8-20(31)9-7-19)23(18-4-3-5-21(32)14-18)17-26(29(27,30)36)33-28(35)34-10-12-39-13-11-34/h3-9,14-16,23,26,36H,10-13,17H2,1-2H3,(H,33,35)/t23-,26-,29+,30-/m0/s1 |
| InChIKey | YTGSEQCJKJKHLQ-STTJFPABSA-N |
| XLogP | 4.57 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |