About 1-benzofuran-6,7-dithiol
1-benzofuran-6,7-dithiol (PubChem CID 167495645) has the molecular formula C8H6OS2
and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-benzofuran-6,7-dithiol.
Molecular Properties
| Compound Name | 1-benzofuran-6,7-dithiol |
| PubChem CID | 167495645 |
| Molecular Formula | C8H6OS2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 1-benzofuran-6,7-dithiol |
| SMILES | Sc1ccc2ccoc2c1S |
| InChI | InChI=1S/C8H6OS2/c10-6-2-1-5-3-4-9-7(5)8(6)11/h1-4,10-11H |
| InChIKey | CFZKTYIJTQJFLZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-6,7-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-6,7-dithiol?
The IUPAC name of 1-benzofuran-6,7-dithiol (CID 167495645) is 1-benzofuran-6,7-dithiol.
What is the SMILES notation for 1-benzofuran-6,7-dithiol?
The canonical SMILES for 1-benzofuran-6,7-dithiol is Sc1ccc2ccoc2c1S.
What is the InChIKey of 1-benzofuran-6,7-dithiol?
The InChIKey is CFZKTYIJTQJFLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6OS2/c10-6-2-1-5-3-4-9-7(5)8(6)11/h1-4,10-11H.
What are the key properties of 1-benzofuran-6,7-dithiol?
1-benzofuran-6,7-dithiol has a molecular weight of 182.27 g/mol, XLogP of 3.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-6,7-dithiol is sourced from PubChem (CID 167495645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).