C21H17ClF3N3O6S — CID 167495725
4-chloro-N-(methoxymethyl)-N-[5-methyl-2-(3-nitrophenoxy)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 167495725) has the molecular formula C21H17ClF3N3O6S and a molecular weight of 531.90 g/mol. Its IUPAC name is 4-chloro-N-(methoxymethyl)-N-[5-methyl-2-(3-nitrophenoxy)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(methoxymethyl)-N-[5-methyl-2-(3-nitrophenoxy)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167495725 |
| Molecular Formula | C21H17ClF3N3O6S |
| Molecular Weight | 531.90 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 4-chloro-N-(methoxymethyl)-N-[5-methyl-2-(3-nitrophenoxy)-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COCN(c1cc(C)cnc1Oc1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17ClF3N3O6S/c1-13-8-19(20(26-11-13)34-15-5-3-4-14(9-15)28(29)30)27(12-33-2)35(31,32)16-6-7-18(22)17(10-16)21(23,24)25/h3-11H,12H2,1-2H3 |
| InChIKey | IEHRZPUAVHQAHF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.90 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|