C17H16BrN3O5 — CID 167495872
(E)-4-bromo-N-[3-methoxy-4-[(5-methyl-3-nitro-2-pyridinyl)oxy]phenyl]but-2-enamide (PubChem CID 167495872) has the molecular formula C17H16BrN3O5 and a molecular weight of 422.24 g/mol. Its IUPAC name is (E)-4-bromo-N-[3-methoxy-4-[(5-methyl-3-nitro-2-pyridinyl)oxy]phenyl]but-2-enamide.
| Compound Name | (E)-4-bromo-N-[3-methoxy-4-[(5-methyl-3-nitro-2-pyridinyl)oxy]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 167495872 |
| Molecular Formula | C17H16BrN3O5 |
| Molecular Weight | 422.24 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (E)-4-bromo-N-[3-methoxy-4-[(5-methyl-3-nitro-2-pyridinyl)oxy]phenyl]but-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/CBr)ccc1Oc1ncc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16BrN3O5/c1-11-8-13(21(23)24)17(19-10-11)26-14-6-5-12(9-15(14)25-2)20-16(22)4-3-7-18/h3-6,8-10H,7H2,1-2H3,(H,20,22)/b4-3+ |
| InChIKey | LLPIRIGWBUPKAU-ONEGZZNKSA-N |
| XLogP | 3.99 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|