C13H12FN5O2 — CID 167496025
N-[5-[(3-amino-5-methyl-2-pyridinyl)oxy]pyrazin-2-yl]-2-fluoroprop-2-enamide (PubChem CID 167496025) has the molecular formula C13H12FN5O2 and a molecular weight of 289.27 g/mol. Its IUPAC name is N-[5-[(3-amino-5-methyl-2-pyridinyl)oxy]pyrazin-2-yl]-2-fluoroprop-2-enamide.
| Compound Name | N-[5-[(3-amino-5-methyl-2-pyridinyl)oxy]pyrazin-2-yl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 167496025 |
| Molecular Formula | C13H12FN5O2 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[5-[(3-amino-5-methyl-2-pyridinyl)oxy]pyrazin-2-yl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cnc(Oc2ncc(C)cc2N)cn1 |
| InChI | InChI=1S/C13H12FN5O2/c1-7-3-9(15)13(18-4-7)21-11-6-16-10(5-17-11)19-12(20)8(2)14/h3-6H,2,15H2,1H3,(H,16,19,20) |
| InChIKey | MTPOQBNQVUQLRV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|